New bis(phosphines) derived from N,N '-substituted ethylenediamine derivatives. Synthesis and transition metal chemistry of X2PN(R)CH2CH2(R)NPX2 (R = CH2Ph or Ph, X = Ph; R = CH2Ph, X2 = O2C6H4). The crystal and molecular structure of Ph2PN(CH2Ph)CH2CH2(CH2Ph)NPPh2 and cis-[{PtCl2Ph2PN(CH2Ph)CH2CH2(CH2Ph)NPPh2}]
1999 ◽
pp. 1407
◽
1981 ◽
pp. 2220-2229
◽
2001 ◽
Vol 628
(1)
◽
pp. 76-80
◽
1978 ◽
pp. 1255-1260
◽
1981 ◽
pp. 2235-2244
◽
1978 ◽
pp. 1247-1255
◽
1996 ◽
Vol 118
(43)
◽
pp. 10678-10678
◽